C13H12ClN5O — CID 169396266
2,4-diamino-6-[4-(2-chloroethoxy)phenyl]pyrimidine-5-carbonitrile (PubChem CID 169396266) has the molecular formula C13H12ClN5O and a molecular weight of 289.73 g/mol. Its IUPAC name is 2,4-diamino-6-[4-(2-chloroethoxy)phenyl]pyrimidine-5-carbonitrile.
| Compound Name | 2,4-diamino-6-[4-(2-chloroethoxy)phenyl]pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 169396266 |
| Molecular Formula | C13H12ClN5O |
| Molecular Weight | 289.73 g/mol |
| Exact Mass | 289.07 |
| IUPAC Name | 2,4-diamino-6-[4-(2-chloroethoxy)phenyl]pyrimidine-5-carbonitrile |
| SMILES | N#Cc1c(N)nc(N)nc1-c1ccc(OCCCl)cc1 |
| InChI | InChI=1S/C13H12ClN5O/c14-5-6-20-9-3-1-8(2-4-9)11-10(7-15)12(16)19-13(17)18-11/h1-4H,5-6H2,(H4,16,17,18,19) |
| InChIKey | ZFYCCUZYRRZKET-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 110.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.73 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|