C15H13N5O2 — CID 169397778
[4-(2,6-diamino-5-cyanopyrimidin-4-yl)phenyl] cyclopropanecarboxylate (PubChem CID 169397778) has the molecular formula C15H13N5O2 and a molecular weight of 295.30 g/mol. Its IUPAC name is [4-(2,6-diamino-5-cyanopyrimidin-4-yl)phenyl] cyclopropanecarboxylate.
| Compound Name | [4-(2,6-diamino-5-cyanopyrimidin-4-yl)phenyl] cyclopropanecarboxylate |
|---|---|
| PubChem CID | 169397778 |
| Molecular Formula | C15H13N5O2 |
| Molecular Weight | 295.30 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | [4-(2,6-diamino-5-cyanopyrimidin-4-yl)phenyl] cyclopropanecarboxylate |
| SMILES | N#Cc1c(N)nc(N)nc1-c1ccc(OC(=O)C2CC2)cc1 |
| InChI | InChI=1S/C15H13N5O2/c16-7-11-12(19-15(18)20-13(11)17)8-3-5-10(6-4-8)22-14(21)9-1-2-9/h3-6,9H,1-2H2,(H4,17,18,19,20) |
| InChIKey | FEQXCQPENXQNEC-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 127.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.30 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|