C15H17N5S — CID 169396556
2,4-diamino-6-(4-butylsulfanylphenyl)pyrimidine-5-carbonitrile (PubChem CID 169396556) has the molecular formula C15H17N5S and a molecular weight of 299.40 g/mol. Its IUPAC name is 2,4-diamino-6-(4-butylsulfanylphenyl)pyrimidine-5-carbonitrile.
| Compound Name | 2,4-diamino-6-(4-butylsulfanylphenyl)pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 169396556 |
| Molecular Formula | C15H17N5S |
| Molecular Weight | 299.40 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | 2,4-diamino-6-(4-butylsulfanylphenyl)pyrimidine-5-carbonitrile |
| SMILES | CCCCSc1ccc(-c2nc(N)nc(N)c2C#N)cc1 |
| InChI | InChI=1S/C15H17N5S/c1-2-3-8-21-11-6-4-10(5-7-11)13-12(9-16)14(17)20-15(18)19-13/h4-7H,2-3,8H2,1H3,(H4,17,18,19,20) |
| InChIKey | SFMHNUYINJAKNY-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 101.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.40 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|