C15H16FN5O — CID 169396618
2,4-diamino-6-[3-fluoro-4-(propoxymethyl)phenyl]pyrimidine-5-carbonitrile (PubChem CID 169396618) has the molecular formula C15H16FN5O and a molecular weight of 301.33 g/mol. Its IUPAC name is 2,4-diamino-6-[3-fluoro-4-(propoxymethyl)phenyl]pyrimidine-5-carbonitrile.
| Compound Name | 2,4-diamino-6-[3-fluoro-4-(propoxymethyl)phenyl]pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 169396618 |
| Molecular Formula | C15H16FN5O |
| Molecular Weight | 301.33 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | 2,4-diamino-6-[3-fluoro-4-(propoxymethyl)phenyl]pyrimidine-5-carbonitrile |
| SMILES | CCCOCc1ccc(-c2nc(N)nc(N)c2C#N)cc1F |
| InChI | InChI=1S/C15H16FN5O/c1-2-5-22-8-10-4-3-9(6-12(10)16)13-11(7-17)14(18)21-15(19)20-13/h3-4,6H,2,5,8H2,1H3,(H4,18,19,20,21) |
| InChIKey | LWYGUSSACNSHCQ-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 110.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.33 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|