C12H9BrFN5 — CID 169398795
2,4-diamino-6-[3-(bromomethyl)-4-fluorophenyl]pyrimidine-5-carbonitrile (PubChem CID 169398795) has the molecular formula C12H9BrFN5 and a molecular weight of 322.14 g/mol. Its IUPAC name is 2,4-diamino-6-[3-(bromomethyl)-4-fluorophenyl]pyrimidine-5-carbonitrile.
| Compound Name | 2,4-diamino-6-[3-(bromomethyl)-4-fluorophenyl]pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 169398795 |
| Molecular Formula | C12H9BrFN5 |
| Molecular Weight | 322.14 g/mol |
| Exact Mass | 321.00 |
| IUPAC Name | 2,4-diamino-6-[3-(bromomethyl)-4-fluorophenyl]pyrimidine-5-carbonitrile |
| SMILES | N#Cc1c(N)nc(N)nc1-c1ccc(F)c(CBr)c1 |
| InChI | InChI=1S/C12H9BrFN5/c13-4-7-3-6(1-2-9(7)14)10-8(5-15)11(16)19-12(17)18-10/h1-3H,4H2,(H4,16,17,18,19) |
| InChIKey | JCKNIQKHBPUPDS-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 101.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.14 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|