C17H21N5O — CID 169396591
2,4-diamino-6-[2-(pentoxymethyl)phenyl]pyrimidine-5-carbonitrile (PubChem CID 169396591) has the molecular formula C17H21N5O and a molecular weight of 311.39 g/mol. Its IUPAC name is 2,4-diamino-6-[2-(pentoxymethyl)phenyl]pyrimidine-5-carbonitrile.
| Compound Name | 2,4-diamino-6-[2-(pentoxymethyl)phenyl]pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 169396591 |
| Molecular Formula | C17H21N5O |
| Molecular Weight | 311.39 g/mol |
| Exact Mass | 311.17 |
| IUPAC Name | 2,4-diamino-6-[2-(pentoxymethyl)phenyl]pyrimidine-5-carbonitrile |
| SMILES | CCCCCOCc1ccccc1-c1nc(N)nc(N)c1C#N |
| InChI | InChI=1S/C17H21N5O/c1-2-3-6-9-23-11-12-7-4-5-8-13(12)15-14(10-18)16(19)22-17(20)21-15/h4-5,7-8H,2-3,6,9,11H2,1H3,(H4,19,20,21,22) |
| InChIKey | QMKVJTGDLVCEMU-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 110.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.39 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|