C16H20BN5O3 — CID 169398937
[2-butoxy-3-(2,6-diamino-5-cyanopyrimidin-4-yl)-5-methylphenyl]boronic acid (PubChem CID 169398937) has the molecular formula C16H20BN5O3 and a molecular weight of 341.18 g/mol. Its IUPAC name is [2-butoxy-3-(2,6-diamino-5-cyanopyrimidin-4-yl)-5-methylphenyl]boronic acid.
| Compound Name | [2-butoxy-3-(2,6-diamino-5-cyanopyrimidin-4-yl)-5-methylphenyl]boronic acid |
|---|---|
| PubChem CID | 169398937 |
| Molecular Formula | C16H20BN5O3 |
| Molecular Weight | 341.18 g/mol |
| Exact Mass | 341.17 |
| IUPAC Name | [2-butoxy-3-(2,6-diamino-5-cyanopyrimidin-4-yl)-5-methylphenyl]boronic acid |
| SMILES | CCCCOc1c(B(O)O)cc(C)cc1-c1nc(N)nc(N)c1C#N |
| InChI | InChI=1S/C16H20BN5O3/c1-3-4-5-25-14-10(6-9(2)7-12(14)17(23)24)13-11(8-18)15(19)22-16(20)21-13/h6-7,23-24H,3-5H2,1-2H3,(H4,19,20,21,22) |
| InChIKey | HTJDDCCLFSNMEK-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 151.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.18 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|