C18H21BN2O4 — CID 168585330
[2-butoxy-3-(3-cyano-6-methyl-2-oxo-1H-pyridin-4-yl)-5-methylphenyl]boronic acid (PubChem CID 168585330) has the molecular formula C18H21BN2O4 and a molecular weight of 340.19 g/mol. Its IUPAC name is [2-butoxy-3-(3-cyano-6-methyl-2-oxo-1H-pyridin-4-yl)-5-methylphenyl]boronic acid.
| Compound Name | [2-butoxy-3-(3-cyano-6-methyl-2-oxo-1H-pyridin-4-yl)-5-methylphenyl]boronic acid |
|---|---|
| PubChem CID | 168585330 |
| Molecular Formula | C18H21BN2O4 |
| Molecular Weight | 340.19 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | [2-butoxy-3-(3-cyano-6-methyl-2-oxo-1H-pyridin-4-yl)-5-methylphenyl]boronic acid |
| SMILES | CCCCOc1c(B(O)O)cc(C)cc1-c1cc(C)[nH]c(=O)c1C#N |
| InChI | InChI=1S/C18H21BN2O4/c1-4-5-6-25-17-14(7-11(2)8-16(17)19(23)24)13-9-12(3)21-18(22)15(13)10-20/h7-9,23-24H,4-6H2,1-3H3,(H,21,22) |
| InChIKey | WCQLSUBZNRVKDE-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.19 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|