C21H19BN2O5 — CID 168585730
[5-(3-cyano-6-methyl-2-oxo-1H-pyridin-4-yl)-3-methoxy-2-phenylmethoxyphenyl]boronic acid (PubChem CID 168585730) has the molecular formula C21H19BN2O5 and a molecular weight of 390.20 g/mol. Its IUPAC name is [5-(3-cyano-6-methyl-2-oxo-1H-pyridin-4-yl)-3-methoxy-2-phenylmethoxyphenyl]boronic acid.
| Compound Name | [5-(3-cyano-6-methyl-2-oxo-1H-pyridin-4-yl)-3-methoxy-2-phenylmethoxyphenyl]boronic acid |
|---|---|
| PubChem CID | 168585730 |
| Molecular Formula | C21H19BN2O5 |
| Molecular Weight | 390.20 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | [5-(3-cyano-6-methyl-2-oxo-1H-pyridin-4-yl)-3-methoxy-2-phenylmethoxyphenyl]boronic acid |
| SMILES | COc1cc(-c2cc(C)[nH]c(=O)c2C#N)cc(B(O)O)c1OCc1ccccc1 |
| InChI | InChI=1S/C21H19BN2O5/c1-13-8-16(17(11-23)21(25)24-13)15-9-18(22(26)27)20(19(10-15)28-2)29-12-14-6-4-3-5-7-14/h3-10,26-27H,12H2,1-2H3,(H,24,25) |
| InChIKey | BUPZGVWRYSPIQV-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 115.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.20 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|