C21H15IN4O3 — CID 169395098
2-amino-4-(3-iodo-5-methoxy-4-phenylmethoxyphenyl)-6-oxo-1H-pyridine-3,5-dicarbonitrile (PubChem CID 169395098) has the molecular formula C21H15IN4O3 and a molecular weight of 498.28 g/mol. Its IUPAC name is 2-amino-4-(3-iodo-5-methoxy-4-phenylmethoxyphenyl)-6-oxo-1H-pyridine-3,5-dicarbonitrile.
| Compound Name | 2-amino-4-(3-iodo-5-methoxy-4-phenylmethoxyphenyl)-6-oxo-1H-pyridine-3,5-dicarbonitrile |
|---|---|
| PubChem CID | 169395098 |
| Molecular Formula | C21H15IN4O3 |
| Molecular Weight | 498.28 g/mol |
| Exact Mass | 498.02 |
| IUPAC Name | 2-amino-4-(3-iodo-5-methoxy-4-phenylmethoxyphenyl)-6-oxo-1H-pyridine-3,5-dicarbonitrile |
| SMILES | COc1cc(-c2c(C#N)c(N)[nH]c(=O)c2C#N)cc(I)c1OCc1ccccc1 |
| InChI | InChI=1S/C21H15IN4O3/c1-28-17-8-13(18-14(9-23)20(25)26-21(27)15(18)10-24)7-16(22)19(17)29-11-12-5-3-2-4-6-12/h2-8H,11H2,1H3,(H3,25,26,27) |
| InChIKey | GZTLQVFEVKURAP-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 124.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.28 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|