C17H15IN4O3 — CID 169395097
2-amino-4-(3-iodo-5-methoxy-4-propan-2-yloxyphenyl)-6-oxo-1H-pyridine-3,5-dicarbonitrile (PubChem CID 169395097) has the molecular formula C17H15IN4O3 and a molecular weight of 450.24 g/mol. Its IUPAC name is 2-amino-4-(3-iodo-5-methoxy-4-propan-2-yloxyphenyl)-6-oxo-1H-pyridine-3,5-dicarbonitrile.
| Compound Name | 2-amino-4-(3-iodo-5-methoxy-4-propan-2-yloxyphenyl)-6-oxo-1H-pyridine-3,5-dicarbonitrile |
|---|---|
| PubChem CID | 169395097 |
| Molecular Formula | C17H15IN4O3 |
| Molecular Weight | 450.24 g/mol |
| Exact Mass | 450.02 |
| IUPAC Name | 2-amino-4-(3-iodo-5-methoxy-4-propan-2-yloxyphenyl)-6-oxo-1H-pyridine-3,5-dicarbonitrile |
| SMILES | COc1cc(-c2c(C#N)c(N)[nH]c(=O)c2C#N)cc(I)c1OC(C)C |
| InChI | InChI=1S/C17H15IN4O3/c1-8(2)25-15-12(18)4-9(5-13(15)24-3)14-10(6-19)16(21)22-17(23)11(14)7-20/h4-5,8H,1-3H3,(H3,21,22,23) |
| InChIKey | IYRRMXQOVDJCGT-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 124.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.24 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|