C18H16N4O3 — CID 169394165
2-amino-4-(3,4-dimethoxy-5-prop-2-enylphenyl)-6-oxo-1H-pyridine-3,5-dicarbonitrile (PubChem CID 169394165) has the molecular formula C18H16N4O3 and a molecular weight of 336.35 g/mol. Its IUPAC name is 2-amino-4-(3,4-dimethoxy-5-prop-2-enylphenyl)-6-oxo-1H-pyridine-3,5-dicarbonitrile.
| Compound Name | 2-amino-4-(3,4-dimethoxy-5-prop-2-enylphenyl)-6-oxo-1H-pyridine-3,5-dicarbonitrile |
|---|---|
| PubChem CID | 169394165 |
| Molecular Formula | C18H16N4O3 |
| Molecular Weight | 336.35 g/mol |
| Exact Mass | 336.12 |
| IUPAC Name | 2-amino-4-(3,4-dimethoxy-5-prop-2-enylphenyl)-6-oxo-1H-pyridine-3,5-dicarbonitrile |
| SMILES | C=CCc1cc(-c2c(C#N)c(N)[nH]c(=O)c2C#N)cc(OC)c1OC |
| InChI | InChI=1S/C18H16N4O3/c1-4-5-10-6-11(7-14(24-2)16(10)25-3)15-12(8-19)17(21)22-18(23)13(15)9-20/h4,6-7H,1,5H2,2-3H3,(H3,21,22,23) |
| InChIKey | HFIXONCANJMNJZ-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 124.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.35 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|