C15H11IN4O3 — CID 169393341
2-amino-4-(3-iodo-4,5-dimethoxyphenyl)-6-oxo-1H-pyridine-3,5-dicarbonitrile (PubChem CID 169393341) has the molecular formula C15H11IN4O3 and a molecular weight of 422.18 g/mol. Its IUPAC name is 2-amino-4-(3-iodo-4,5-dimethoxyphenyl)-6-oxo-1H-pyridine-3,5-dicarbonitrile.
| Compound Name | 2-amino-4-(3-iodo-4,5-dimethoxyphenyl)-6-oxo-1H-pyridine-3,5-dicarbonitrile |
|---|---|
| PubChem CID | 169393341 |
| Molecular Formula | C15H11IN4O3 |
| Molecular Weight | 422.18 g/mol |
| Exact Mass | 421.99 |
| IUPAC Name | 2-amino-4-(3-iodo-4,5-dimethoxyphenyl)-6-oxo-1H-pyridine-3,5-dicarbonitrile |
| SMILES | COc1cc(-c2c(C#N)c(N)[nH]c(=O)c2C#N)cc(I)c1OC |
| InChI | InChI=1S/C15H11IN4O3/c1-22-11-4-7(3-10(16)13(11)23-2)12-8(5-17)14(19)20-15(21)9(12)6-18/h3-4H,1-2H3,(H3,19,20,21) |
| InChIKey | GJTVXACYJMOKET-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 124.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.18 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|