C16H12N4O4 — CID 169393074
[4-(2-amino-3,5-dicyano-6-oxo-1H-pyridin-4-yl)-2-methoxyphenyl] acetate (PubChem CID 169393074) has the molecular formula C16H12N4O4 and a molecular weight of 324.30 g/mol. Its IUPAC name is [4-(2-amino-3,5-dicyano-6-oxo-1H-pyridin-4-yl)-2-methoxyphenyl] acetate.
| Compound Name | [4-(2-amino-3,5-dicyano-6-oxo-1H-pyridin-4-yl)-2-methoxyphenyl] acetate |
|---|---|
| PubChem CID | 169393074 |
| Molecular Formula | C16H12N4O4 |
| Molecular Weight | 324.30 g/mol |
| Exact Mass | 324.09 |
| IUPAC Name | [4-(2-amino-3,5-dicyano-6-oxo-1H-pyridin-4-yl)-2-methoxyphenyl] acetate |
| SMILES | COc1cc(-c2c(C#N)c(N)[nH]c(=O)c2C#N)ccc1OC(C)=O |
| InChI | InChI=1S/C16H12N4O4/c1-8(21)24-12-4-3-9(5-13(12)23-2)14-10(6-17)15(19)20-16(22)11(14)7-18/h3-5H,1-2H3,(H3,19,20,22) |
| InChIKey | MRXKOLMUMOJPLC-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 141.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.30 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|