C20H13N5O5 — CID 169394466
2-amino-4-[3-methoxy-4-(4-nitrophenoxy)phenyl]-6-oxo-1H-pyridine-3,5-dicarbonitrile (PubChem CID 169394466) has the molecular formula C20H13N5O5 and a molecular weight of 403.35 g/mol. Its IUPAC name is 2-amino-4-[3-methoxy-4-(4-nitrophenoxy)phenyl]-6-oxo-1H-pyridine-3,5-dicarbonitrile.
| Compound Name | 2-amino-4-[3-methoxy-4-(4-nitrophenoxy)phenyl]-6-oxo-1H-pyridine-3,5-dicarbonitrile |
|---|---|
| PubChem CID | 169394466 |
| Molecular Formula | C20H13N5O5 |
| Molecular Weight | 403.35 g/mol |
| Exact Mass | 403.09 |
| IUPAC Name | 2-amino-4-[3-methoxy-4-(4-nitrophenoxy)phenyl]-6-oxo-1H-pyridine-3,5-dicarbonitrile |
| SMILES | COc1cc(-c2c(C#N)c(N)[nH]c(=O)c2C#N)ccc1Oc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C20H13N5O5/c1-29-17-8-11(18-14(9-21)19(23)24-20(26)15(18)10-22)2-7-16(17)30-13-5-3-12(4-6-13)25(27)28/h2-8H,1H3,(H3,23,24,26) |
| InChIKey | BBVIMSZCWUBKAA-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 168.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.35 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|