C17H14N4O4 — CID 169394799
[4-(2-amino-3,5-dicyano-6-oxo-1H-pyridin-4-yl)-2-methoxyphenyl] propanoate (PubChem CID 169394799) has the molecular formula C17H14N4O4 and a molecular weight of 338.32 g/mol. Its IUPAC name is [4-(2-amino-3,5-dicyano-6-oxo-1H-pyridin-4-yl)-2-methoxyphenyl] propanoate.
| Compound Name | [4-(2-amino-3,5-dicyano-6-oxo-1H-pyridin-4-yl)-2-methoxyphenyl] propanoate |
|---|---|
| PubChem CID | 169394799 |
| Molecular Formula | C17H14N4O4 |
| Molecular Weight | 338.32 g/mol |
| Exact Mass | 338.10 |
| IUPAC Name | [4-(2-amino-3,5-dicyano-6-oxo-1H-pyridin-4-yl)-2-methoxyphenyl] propanoate |
| SMILES | CCC(=O)Oc1ccc(-c2c(C#N)c(N)[nH]c(=O)c2C#N)cc1OC |
| InChI | InChI=1S/C17H14N4O4/c1-3-14(22)25-12-5-4-9(6-13(12)24-2)15-10(7-18)16(20)21-17(23)11(15)8-19/h4-6H,3H2,1-2H3,(H3,20,21,23) |
| InChIKey | MZBLVZWJXABHET-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 141.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.32 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|