C16H11ClN4O4 — CID 169394543
[4-(2-amino-3,5-dicyano-6-oxo-1H-pyridin-4-yl)-2-chloro-6-methoxyphenyl] acetate (PubChem CID 169394543) has the molecular formula C16H11ClN4O4 and a molecular weight of 358.74 g/mol. Its IUPAC name is [4-(2-amino-3,5-dicyano-6-oxo-1H-pyridin-4-yl)-2-chloro-6-methoxyphenyl] acetate.
| Compound Name | [4-(2-amino-3,5-dicyano-6-oxo-1H-pyridin-4-yl)-2-chloro-6-methoxyphenyl] acetate |
|---|---|
| PubChem CID | 169394543 |
| Molecular Formula | C16H11ClN4O4 |
| Molecular Weight | 358.74 g/mol |
| Exact Mass | 358.05 |
| IUPAC Name | [4-(2-amino-3,5-dicyano-6-oxo-1H-pyridin-4-yl)-2-chloro-6-methoxyphenyl] acetate |
| SMILES | COc1cc(-c2c(C#N)c(N)[nH]c(=O)c2C#N)cc(Cl)c1OC(C)=O |
| InChI | InChI=1S/C16H11ClN4O4/c1-7(22)25-14-11(17)3-8(4-12(14)24-2)13-9(5-18)15(20)21-16(23)10(13)6-19/h3-4H,1-2H3,(H3,20,21,23) |
| InChIKey | FOTZFKMMINPWPR-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 141.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.74 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|