C13H5Cl2FN4O — CID 169394089
2-amino-4-(3,4-dichloro-5-fluorophenyl)-6-oxo-1H-pyridine-3,5-dicarbonitrile (PubChem CID 169394089) has the molecular formula C13H5Cl2FN4O and a molecular weight of 323.11 g/mol. Its IUPAC name is 2-amino-4-(3,4-dichloro-5-fluorophenyl)-6-oxo-1H-pyridine-3,5-dicarbonitrile.
| Compound Name | 2-amino-4-(3,4-dichloro-5-fluorophenyl)-6-oxo-1H-pyridine-3,5-dicarbonitrile |
|---|---|
| PubChem CID | 169394089 |
| Molecular Formula | C13H5Cl2FN4O |
| Molecular Weight | 323.11 g/mol |
| Exact Mass | 321.98 |
| IUPAC Name | 2-amino-4-(3,4-dichloro-5-fluorophenyl)-6-oxo-1H-pyridine-3,5-dicarbonitrile |
| SMILES | N#Cc1c(N)[nH]c(=O)c(C#N)c1-c1cc(F)c(Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H5Cl2FN4O/c14-8-1-5(2-9(16)11(8)15)10-6(3-17)12(19)20-13(21)7(10)4-18/h1-2H,(H3,19,20,21) |
| InChIKey | YQNSRWYLSKXSAM-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 106.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.11 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|