C16H8ClN5O — CID 169395255
2-amino-4-(3-chloroisoquinolin-7-yl)-6-oxo-1H-pyridine-3,5-dicarbonitrile (PubChem CID 169395255) has the molecular formula C16H8ClN5O and a molecular weight of 321.73 g/mol. Its IUPAC name is 2-amino-4-(3-chloroisoquinolin-7-yl)-6-oxo-1H-pyridine-3,5-dicarbonitrile.
| Compound Name | 2-amino-4-(3-chloroisoquinolin-7-yl)-6-oxo-1H-pyridine-3,5-dicarbonitrile |
|---|---|
| PubChem CID | 169395255 |
| Molecular Formula | C16H8ClN5O |
| Molecular Weight | 321.73 g/mol |
| Exact Mass | 321.04 |
| IUPAC Name | 2-amino-4-(3-chloroisoquinolin-7-yl)-6-oxo-1H-pyridine-3,5-dicarbonitrile |
| SMILES | N#Cc1c(N)[nH]c(=O)c(C#N)c1-c1ccc2cc(Cl)ncc2c1 |
| InChI | InChI=1S/C16H8ClN5O/c17-13-4-8-1-2-9(3-10(8)7-21-13)14-11(5-18)15(20)22-16(23)12(14)6-19/h1-4,7H,(H3,20,22,23) |
| InChIKey | HCJXGAVKDSPJQK-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 119.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.73 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|