C16H10N4O2 — CID 169393291
2-amino-6-oxo-4-(4-prop-2-ynoxyphenyl)-1H-pyridine-3,5-dicarbonitrile (PubChem CID 169393291) has the molecular formula C16H10N4O2 and a molecular weight of 290.28 g/mol. Its IUPAC name is 2-amino-6-oxo-4-(4-prop-2-ynoxyphenyl)-1H-pyridine-3,5-dicarbonitrile.
| Compound Name | 2-amino-6-oxo-4-(4-prop-2-ynoxyphenyl)-1H-pyridine-3,5-dicarbonitrile |
|---|---|
| PubChem CID | 169393291 |
| Molecular Formula | C16H10N4O2 |
| Molecular Weight | 290.28 g/mol |
| Exact Mass | 290.08 |
| IUPAC Name | 2-amino-6-oxo-4-(4-prop-2-ynoxyphenyl)-1H-pyridine-3,5-dicarbonitrile |
| SMILES | C#CCOc1ccc(-c2c(C#N)c(N)[nH]c(=O)c2C#N)cc1 |
| InChI | InChI=1S/C16H10N4O2/c1-2-7-22-11-5-3-10(4-6-11)14-12(8-17)15(19)20-16(21)13(14)9-18/h1,3-6H,7H2,(H3,19,20,21) |
| InChIKey | BJGNOAOYXYHSMT-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 115.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.28 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|