C20H21N5O3 — CID 169394698
2-amino-4-[4-(3-morpholin-4-ylpropoxy)phenyl]-6-oxo-1H-pyridine-3,5-dicarbonitrile (PubChem CID 169394698) has the molecular formula C20H21N5O3 and a molecular weight of 379.42 g/mol. Its IUPAC name is 2-amino-4-[4-(3-morpholin-4-ylpropoxy)phenyl]-6-oxo-1H-pyridine-3,5-dicarbonitrile.
| Compound Name | 2-amino-4-[4-(3-morpholin-4-ylpropoxy)phenyl]-6-oxo-1H-pyridine-3,5-dicarbonitrile |
|---|---|
| PubChem CID | 169394698 |
| Molecular Formula | C20H21N5O3 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | 2-amino-4-[4-(3-morpholin-4-ylpropoxy)phenyl]-6-oxo-1H-pyridine-3,5-dicarbonitrile |
| SMILES | N#Cc1c(N)[nH]c(=O)c(C#N)c1-c1ccc(OCCCN2CCOCC2)cc1 |
| InChI | InChI=1S/C20H21N5O3/c21-12-16-18(17(13-22)20(26)24-19(16)23)14-2-4-15(5-3-14)28-9-1-6-25-7-10-27-11-8-25/h2-5H,1,6-11H2,(H3,23,24,26) |
| InChIKey | PBYHIFLHELHYRC-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 128.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|