C15H12N4O3 — CID 58284379
6-amino-4-[4-(2-hydroxyethoxy)phenyl]-5-isocyano-2-oxo-1H-pyridine-3-carbonitrile (PubChem CID 58284379) has the molecular formula C15H12N4O3 and a molecular weight of 296.29 g/mol. Its IUPAC name is 6-amino-4-[4-(2-hydroxyethoxy)phenyl]-5-isocyano-2-oxo-1H-pyridine-3-carbonitrile.
| Compound Name | 6-amino-4-[4-(2-hydroxyethoxy)phenyl]-5-isocyano-2-oxo-1H-pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 58284379 |
| Molecular Formula | C15H12N4O3 |
| Molecular Weight | 296.29 g/mol |
| Exact Mass | 296.09 |
| IUPAC Name | 6-amino-4-[4-(2-hydroxyethoxy)phenyl]-5-isocyano-2-oxo-1H-pyridine-3-carbonitrile |
| SMILES | [C-]#[N+]c1c(N)[nH]c(=O)c(C#N)c1-c1ccc(OCCO)cc1 |
| InChI | InChI=1S/C15H12N4O3/c1-18-13-12(11(8-16)15(21)19-14(13)17)9-2-4-10(5-3-9)22-7-6-20/h2-5,20H,6-7H2,(H3,17,19,21) |
| InChIKey | FOWRJLIHSQEJDT-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 116.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.29 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|