C21H14N4O3 — CID 169394787
[4-(2-amino-3,5-dicyano-6-oxo-1H-pyridin-4-yl)phenyl] 4-methylbenzoate (PubChem CID 169394787) has the molecular formula C21H14N4O3 and a molecular weight of 370.37 g/mol. Its IUPAC name is [4-(2-amino-3,5-dicyano-6-oxo-1H-pyridin-4-yl)phenyl] 4-methylbenzoate.
| Compound Name | [4-(2-amino-3,5-dicyano-6-oxo-1H-pyridin-4-yl)phenyl] 4-methylbenzoate |
|---|---|
| PubChem CID | 169394787 |
| Molecular Formula | C21H14N4O3 |
| Molecular Weight | 370.37 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | [4-(2-amino-3,5-dicyano-6-oxo-1H-pyridin-4-yl)phenyl] 4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)Oc2ccc(-c3c(C#N)c(N)[nH]c(=O)c3C#N)cc2)cc1 |
| InChI | InChI=1S/C21H14N4O3/c1-12-2-4-14(5-3-12)21(27)28-15-8-6-13(7-9-15)18-16(10-22)19(24)25-20(26)17(18)11-23/h2-9H,1H3,(H3,24,25,26) |
| InChIKey | PAGZOTLFJQAOBT-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 132.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.37 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|