C17H12N4O3 — CID 169394443
2-amino-4-(5-methoxy-2-prop-2-ynoxyphenyl)-6-oxo-1H-pyridine-3,5-dicarbonitrile (PubChem CID 169394443) has the molecular formula C17H12N4O3 and a molecular weight of 320.31 g/mol. Its IUPAC name is 2-amino-4-(5-methoxy-2-prop-2-ynoxyphenyl)-6-oxo-1H-pyridine-3,5-dicarbonitrile.
| Compound Name | 2-amino-4-(5-methoxy-2-prop-2-ynoxyphenyl)-6-oxo-1H-pyridine-3,5-dicarbonitrile |
|---|---|
| PubChem CID | 169394443 |
| Molecular Formula | C17H12N4O3 |
| Molecular Weight | 320.31 g/mol |
| Exact Mass | 320.09 |
| IUPAC Name | 2-amino-4-(5-methoxy-2-prop-2-ynoxyphenyl)-6-oxo-1H-pyridine-3,5-dicarbonitrile |
| SMILES | C#CCOc1ccc(OC)cc1-c1c(C#N)c(N)[nH]c(=O)c1C#N |
| InChI | InChI=1S/C17H12N4O3/c1-3-6-24-14-5-4-10(23-2)7-11(14)15-12(8-18)16(20)21-17(22)13(15)9-19/h1,4-5,7H,6H2,2H3,(H3,20,21,22) |
| InChIKey | JIIQMSWBWBALTL-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 124.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.31 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|