C15H10N4O4 — CID 169394934
3-(2-amino-3,5-dicyano-6-oxo-1H-pyridin-4-yl)-4-methoxybenzoic acid (PubChem CID 169394934) has the molecular formula C15H10N4O4 and a molecular weight of 310.27 g/mol. Its IUPAC name is 3-(2-amino-3,5-dicyano-6-oxo-1H-pyridin-4-yl)-4-methoxybenzoic acid.
| Compound Name | 3-(2-amino-3,5-dicyano-6-oxo-1H-pyridin-4-yl)-4-methoxybenzoic acid |
|---|---|
| PubChem CID | 169394934 |
| Molecular Formula | C15H10N4O4 |
| Molecular Weight | 310.27 g/mol |
| Exact Mass | 310.07 |
| IUPAC Name | 3-(2-amino-3,5-dicyano-6-oxo-1H-pyridin-4-yl)-4-methoxybenzoic acid |
| SMILES | COc1ccc(C(=O)O)cc1-c1c(C#N)c(N)[nH]c(=O)c1C#N |
| InChI | InChI=1S/C15H10N4O4/c1-23-11-3-2-7(15(21)22)4-8(11)12-9(5-16)13(18)19-14(20)10(12)6-17/h2-4H,1H3,(H,21,22)(H3,18,19,20) |
| InChIKey | IBNXMSOVQDZXPH-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 152.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.27 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |