About tert-butyl 3-(2-amino-3,5-dicyano-6-oxo-1H-pyridin-4-yl)-4-hydroxybenzoate
tert-butyl 3-(2-amino-3,5-dicyano-6-oxo-1H-pyridin-4-yl)-4-hydroxybenzoate (PubChem CID 169395234) has the molecular formula C18H16N4O4
and a molecular weight of 352.35 g/mol. Its IUPAC name is tert-butyl 3-(2-amino-3,5-dicyano-6-oxo-1H-pyridin-4-yl)-4-hydroxybenzoate.
Molecular Properties
| Compound Name | tert-butyl 3-(2-amino-3,5-dicyano-6-oxo-1H-pyridin-4-yl)-4-hydroxybenzoate |
| PubChem CID | 169395234 |
| Molecular Formula | C18H16N4O4 |
| Molecular Weight | 352.35 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | tert-butyl 3-(2-amino-3,5-dicyano-6-oxo-1H-pyridin-4-yl)-4-hydroxybenzoate |
| SMILES | CC(C)(C)OC(=O)c1ccc(O)c(-c2c(C#N)c(N)[nH]c(=O)c2C#N)c1 |
| InChI | InChI=1S/C18H16N4O4/c1-18(2,3)26-17(25)9-4-5-13(23)10(6-9)14-11(7-19)15(21)22-16(24)12(14)8-20/h4-6,23H,1-3H3,(H3,21,22,24) |
| InChIKey | AXYOEBLGUASARN-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 152.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.35 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze tert-butyl 3-(2-amino-3,5-dicyano-6-oxo-1H-pyridin-4-yl)-4-hydroxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 3-(2-amino-3,5-dicyano-6-oxo-1H-pyridin-4-yl)-4-hydroxybenzoate?
The IUPAC name of tert-butyl 3-(2-amino-3,5-dicyano-6-oxo-1H-pyridin-4-yl)-4-hydroxybenzoate (CID 169395234) is tert-butyl 3-(2-amino-3,5-dicyano-6-oxo-1H-pyridin-4-yl)-4-hydroxybenzoate.
What is the SMILES notation for tert-butyl 3-(2-amino-3,5-dicyano-6-oxo-1H-pyridin-4-yl)-4-hydroxybenzoate?
The canonical SMILES for tert-butyl 3-(2-amino-3,5-dicyano-6-oxo-1H-pyridin-4-yl)-4-hydroxybenzoate is CC(C)(C)OC(=O)c1ccc(O)c(-c2c(C#N)c(N)[nH]c(=O)c2C#N)c1.
What is the InChIKey of tert-butyl 3-(2-amino-3,5-dicyano-6-oxo-1H-pyridin-4-yl)-4-hydroxybenzoate?
The InChIKey is AXYOEBLGUASARN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16N4O4/c1-18(2,3)26-17(25)9-4-5-13(23)10(6-9)14-11(7-19)15(21)22-16(24)12(14)8-20/h4-6,23H,1-3H3,(H3,21,22,24).
What are the key properties of tert-butyl 3-(2-amino-3,5-dicyano-6-oxo-1H-pyridin-4-yl)-4-hydroxybenzoate?
tert-butyl 3-(2-amino-3,5-dicyano-6-oxo-1H-pyridin-4-yl)-4-hydroxybenzoate has a molecular weight of 352.35 g/mol, XLogP of 2.03, 2 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 3-(2-amino-3,5-dicyano-6-oxo-1H-pyridin-4-yl)-4-hydroxybenzoate is sourced from PubChem (CID 169395234), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).