C14H8N4O3 — CID 169393283
3-(2-amino-3,5-dicyano-6-oxo-1H-pyridin-4-yl)benzoic acid (PubChem CID 169393283) has the molecular formula C14H8N4O3 and a molecular weight of 280.24 g/mol. Its IUPAC name is 3-(2-amino-3,5-dicyano-6-oxo-1H-pyridin-4-yl)benzoic acid.
| Compound Name | 3-(2-amino-3,5-dicyano-6-oxo-1H-pyridin-4-yl)benzoic acid |
|---|---|
| PubChem CID | 169393283 |
| Molecular Formula | C14H8N4O3 |
| Molecular Weight | 280.24 g/mol |
| Exact Mass | 280.06 |
| IUPAC Name | 3-(2-amino-3,5-dicyano-6-oxo-1H-pyridin-4-yl)benzoic acid |
| SMILES | N#Cc1c(N)[nH]c(=O)c(C#N)c1-c1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C14H8N4O3/c15-5-9-11(10(6-16)13(19)18-12(9)17)7-2-1-3-8(4-7)14(20)21/h1-4H,(H,20,21)(H3,17,18,19) |
| InChIKey | SBKRRNDMUZSLEN-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 143.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.24 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |