C15H10N4O3 — CID 169395905
[2-(2-amino-3,5-dicyano-6-oxo-1H-pyridin-4-yl)phenyl] acetate (PubChem CID 169395905) has the molecular formula C15H10N4O3 and a molecular weight of 294.27 g/mol. Its IUPAC name is [2-(2-amino-3,5-dicyano-6-oxo-1H-pyridin-4-yl)phenyl] acetate.
| Compound Name | [2-(2-amino-3,5-dicyano-6-oxo-1H-pyridin-4-yl)phenyl] acetate |
|---|---|
| PubChem CID | 169395905 |
| Molecular Formula | C15H10N4O3 |
| Molecular Weight | 294.27 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | [2-(2-amino-3,5-dicyano-6-oxo-1H-pyridin-4-yl)phenyl] acetate |
| SMILES | CC(=O)Oc1ccccc1-c1c(C#N)c(N)[nH]c(=O)c1C#N |
| InChI | InChI=1S/C15H10N4O3/c1-8(20)22-12-5-3-2-4-9(12)13-10(6-16)14(18)19-15(21)11(13)7-17/h2-5H,1H3,(H3,18,19,21) |
| InChIKey | PXLHMNLPSDGGJG-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 132.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.27 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|