C18H10N6O4 — CID 169395733
2-amino-4-[4-[(3-nitro-2-pyridinyl)oxy]phenyl]-6-oxo-1H-pyridine-3,5-dicarbonitrile (PubChem CID 169395733) has the molecular formula C18H10N6O4 and a molecular weight of 374.32 g/mol. Its IUPAC name is 2-amino-4-[4-[(3-nitro-2-pyridinyl)oxy]phenyl]-6-oxo-1H-pyridine-3,5-dicarbonitrile.
| Compound Name | 2-amino-4-[4-[(3-nitro-2-pyridinyl)oxy]phenyl]-6-oxo-1H-pyridine-3,5-dicarbonitrile |
|---|---|
| PubChem CID | 169395733 |
| Molecular Formula | C18H10N6O4 |
| Molecular Weight | 374.32 g/mol |
| Exact Mass | 374.08 |
| IUPAC Name | 2-amino-4-[4-[(3-nitro-2-pyridinyl)oxy]phenyl]-6-oxo-1H-pyridine-3,5-dicarbonitrile |
| SMILES | N#Cc1c(N)[nH]c(=O)c(C#N)c1-c1ccc(Oc2ncccc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C18H10N6O4/c19-8-12-15(13(9-20)17(25)23-16(12)21)10-3-5-11(6-4-10)28-18-14(24(26)27)2-1-7-22-18/h1-7H,(H3,21,23,25) |
| InChIKey | DSDJXGXTHXNAMI-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 171.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.32 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|