About 3-nitro-2-phenoxypyridine;2-phenoxypyridin-3-amine
3-nitro-2-phenoxypyridine;2-phenoxypyridin-3-amine (PubChem CID 160580310) has the molecular formula C22H18N4O4
and a molecular weight of 402.41 g/mol. Its IUPAC name is 3-nitro-2-phenoxypyridine;2-phenoxypyridin-3-amine.
Molecular Properties
| Compound Name | 3-nitro-2-phenoxypyridine;2-phenoxypyridin-3-amine |
| PubChem CID | 160580310 |
| Molecular Formula | C22H18N4O4 |
| Molecular Weight | 402.41 g/mol |
| Exact Mass | 402.13 |
| IUPAC Name | 3-nitro-2-phenoxypyridine;2-phenoxypyridin-3-amine |
| SMILES | Nc1cccnc1Oc1ccccc1.O=[N+]([O-])c1cccnc1Oc1ccccc1 |
| InChI | InChI=1S/C11H8N2O3.C11H10N2O/c14-13(15)10-7-4-8-12-11(10)16-9-5-2-1-3-6-9;12-10-7-4-8-13-11(10)14-9-5-2-1-3-6-9/h1-8H;1-8H,12H2 |
| InChIKey | RBRRHBVLWCVVMQ-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 113.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 402.41 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-nitro-2-phenoxypyridine;2-phenoxypyridin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-nitro-2-phenoxypyridine;2-phenoxypyridin-3-amine?
The IUPAC name of 3-nitro-2-phenoxypyridine;2-phenoxypyridin-3-amine (CID 160580310) is 3-nitro-2-phenoxypyridine;2-phenoxypyridin-3-amine.
What is the SMILES notation for 3-nitro-2-phenoxypyridine;2-phenoxypyridin-3-amine?
The canonical SMILES for 3-nitro-2-phenoxypyridine;2-phenoxypyridin-3-amine is Nc1cccnc1Oc1ccccc1.O=[N+]([O-])c1cccnc1Oc1ccccc1.
What is the InChIKey of 3-nitro-2-phenoxypyridine;2-phenoxypyridin-3-amine?
The InChIKey is RBRRHBVLWCVVMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8N2O3.C11H10N2O/c14-13(15)10-7-4-8-12-11(10)16-9-5-2-1-3-6-9;12-10-7-4-8-13-11(10)14-9-5-2-1-3-6-9/h1-8H;1-8H,12H2.
What are the key properties of 3-nitro-2-phenoxypyridine;2-phenoxypyridin-3-amine?
3-nitro-2-phenoxypyridine;2-phenoxypyridin-3-amine has a molecular weight of 402.41 g/mol, XLogP of 5.24, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-nitro-2-phenoxypyridine;2-phenoxypyridin-3-amine is sourced from PubChem (CID 160580310), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).