C18H18N2O7 — CID 169406145
2-amino-4-(3,4-dimethoxy-5-prop-2-enylphenyl)-6-oxo-1H-pyridine-3,5-dicarboxylic acid (PubChem CID 169406145) has the molecular formula C18H18N2O7 and a molecular weight of 374.35 g/mol. Its IUPAC name is 2-amino-4-(3,4-dimethoxy-5-prop-2-enylphenyl)-6-oxo-1H-pyridine-3,5-dicarboxylic acid.
| Compound Name | 2-amino-4-(3,4-dimethoxy-5-prop-2-enylphenyl)-6-oxo-1H-pyridine-3,5-dicarboxylic acid |
|---|---|
| PubChem CID | 169406145 |
| Molecular Formula | C18H18N2O7 |
| Molecular Weight | 374.35 g/mol |
| Exact Mass | 374.11 |
| IUPAC Name | 2-amino-4-(3,4-dimethoxy-5-prop-2-enylphenyl)-6-oxo-1H-pyridine-3,5-dicarboxylic acid |
| SMILES | C=CCc1cc(-c2c(C(=O)O)c(N)[nH]c(=O)c2C(=O)O)cc(OC)c1OC |
| InChI | InChI=1S/C18H18N2O7/c1-4-5-8-6-9(7-10(26-2)14(8)27-3)11-12(17(22)23)15(19)20-16(21)13(11)18(24)25/h4,6-7H,1,5H2,2-3H3,(H,22,23)(H,24,25)(H3,19,20,21) |
| InChIKey | PBYCDWLSRGCMNB-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 151.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.35 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|