C17H17IN2O7 — CID 169406589
2-amino-4-(3,4-diethoxy-5-iodophenyl)-6-oxo-1H-pyridine-3,5-dicarboxylic acid (PubChem CID 169406589) has the molecular formula C17H17IN2O7 and a molecular weight of 488.23 g/mol. Its IUPAC name is 2-amino-4-(3,4-diethoxy-5-iodophenyl)-6-oxo-1H-pyridine-3,5-dicarboxylic acid.
| Compound Name | 2-amino-4-(3,4-diethoxy-5-iodophenyl)-6-oxo-1H-pyridine-3,5-dicarboxylic acid |
|---|---|
| PubChem CID | 169406589 |
| Molecular Formula | C17H17IN2O7 |
| Molecular Weight | 488.23 g/mol |
| Exact Mass | 488.01 |
| IUPAC Name | 2-amino-4-(3,4-diethoxy-5-iodophenyl)-6-oxo-1H-pyridine-3,5-dicarboxylic acid |
| SMILES | CCOc1cc(-c2c(C(=O)O)c(N)[nH]c(=O)c2C(=O)O)cc(I)c1OCC |
| InChI | InChI=1S/C17H17IN2O7/c1-3-26-9-6-7(5-8(18)13(9)27-4-2)10-11(16(22)23)14(19)20-15(21)12(10)17(24)25/h5-6H,3-4H2,1-2H3,(H,22,23)(H,24,25)(H3,19,20,21) |
| InChIKey | RJXCGXVIWWYYJE-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 151.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.23 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|