C22H17ClN2O8 — CID 169406781
2-amino-4-[4-(2-chlorobenzoyl)oxy-3-ethoxyphenyl]-6-oxo-1H-pyridine-3,5-dicarboxylic acid (PubChem CID 169406781) has the molecular formula C22H17ClN2O8 and a molecular weight of 472.84 g/mol. Its IUPAC name is 2-amino-4-[4-(2-chlorobenzoyl)oxy-3-ethoxyphenyl]-6-oxo-1H-pyridine-3,5-dicarboxylic acid.
| Compound Name | 2-amino-4-[4-(2-chlorobenzoyl)oxy-3-ethoxyphenyl]-6-oxo-1H-pyridine-3,5-dicarboxylic acid |
|---|---|
| PubChem CID | 169406781 |
| Molecular Formula | C22H17ClN2O8 |
| Molecular Weight | 472.84 g/mol |
| Exact Mass | 472.07 |
| IUPAC Name | 2-amino-4-[4-(2-chlorobenzoyl)oxy-3-ethoxyphenyl]-6-oxo-1H-pyridine-3,5-dicarboxylic acid |
| SMILES | CCOc1cc(-c2c(C(=O)O)c(N)[nH]c(=O)c2C(=O)O)ccc1OC(=O)c1ccccc1Cl |
| InChI | InChI=1S/C22H17ClN2O8/c1-2-32-14-9-10(7-8-13(14)33-22(31)11-5-3-4-6-12(11)23)15-16(20(27)28)18(24)25-19(26)17(15)21(29)30/h3-9H,2H2,1H3,(H,27,28)(H,29,30)(H3,24,25,26) |
| InChIKey | YNDXCBAOAFGEJT-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 169.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.84 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|