C18H17ClN2O7 — CID 169406525
2-amino-4-(2-chloro-5-ethoxy-4-prop-2-enoxyphenyl)-6-oxo-1H-pyridine-3,5-dicarboxylic acid (PubChem CID 169406525) has the molecular formula C18H17ClN2O7 and a molecular weight of 408.79 g/mol. Its IUPAC name is 2-amino-4-(2-chloro-5-ethoxy-4-prop-2-enoxyphenyl)-6-oxo-1H-pyridine-3,5-dicarboxylic acid.
| Compound Name | 2-amino-4-(2-chloro-5-ethoxy-4-prop-2-enoxyphenyl)-6-oxo-1H-pyridine-3,5-dicarboxylic acid |
|---|---|
| PubChem CID | 169406525 |
| Molecular Formula | C18H17ClN2O7 |
| Molecular Weight | 408.79 g/mol |
| Exact Mass | 408.07 |
| IUPAC Name | 2-amino-4-(2-chloro-5-ethoxy-4-prop-2-enoxyphenyl)-6-oxo-1H-pyridine-3,5-dicarboxylic acid |
| SMILES | C=CCOc1cc(Cl)c(-c2c(C(=O)O)c(N)[nH]c(=O)c2C(=O)O)cc1OCC |
| InChI | InChI=1S/C18H17ClN2O7/c1-3-5-28-11-7-9(19)8(6-10(11)27-4-2)12-13(17(23)24)15(20)21-16(22)14(12)18(25)26/h3,6-7H,1,4-5H2,2H3,(H,23,24)(H,25,26)(H3,20,21,22) |
| InChIKey | QKTYQWHXPHCALI-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 151.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.79 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|