C19H21BrN2O7 — CID 169407046
2-amino-4-(2-bromo-4-butoxy-5-ethoxyphenyl)-6-oxo-1H-pyridine-3,5-dicarboxylic acid (PubChem CID 169407046) has the molecular formula C19H21BrN2O7 and a molecular weight of 469.29 g/mol. Its IUPAC name is 2-amino-4-(2-bromo-4-butoxy-5-ethoxyphenyl)-6-oxo-1H-pyridine-3,5-dicarboxylic acid.
| Compound Name | 2-amino-4-(2-bromo-4-butoxy-5-ethoxyphenyl)-6-oxo-1H-pyridine-3,5-dicarboxylic acid |
|---|---|
| PubChem CID | 169407046 |
| Molecular Formula | C19H21BrN2O7 |
| Molecular Weight | 469.29 g/mol |
| Exact Mass | 468.05 |
| IUPAC Name | 2-amino-4-(2-bromo-4-butoxy-5-ethoxyphenyl)-6-oxo-1H-pyridine-3,5-dicarboxylic acid |
| SMILES | CCCCOc1cc(Br)c(-c2c(C(=O)O)c(N)[nH]c(=O)c2C(=O)O)cc1OCC |
| InChI | InChI=1S/C19H21BrN2O7/c1-3-5-6-29-12-8-10(20)9(7-11(12)28-4-2)13-14(18(24)25)16(21)22-17(23)15(13)19(26)27/h7-8H,3-6H2,1-2H3,(H,24,25)(H,26,27)(H3,21,22,23) |
| InChIKey | WNYLTKFIXYAUGZ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 151.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.29 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|