C18H19FN2O6 — CID 169405481
2-amino-4-(4-fluoro-3-pentoxyphenyl)-6-oxo-1H-pyridine-3,5-dicarboxylic acid (PubChem CID 169405481) has the molecular formula C18H19FN2O6 and a molecular weight of 378.36 g/mol. Its IUPAC name is 2-amino-4-(4-fluoro-3-pentoxyphenyl)-6-oxo-1H-pyridine-3,5-dicarboxylic acid.
| Compound Name | 2-amino-4-(4-fluoro-3-pentoxyphenyl)-6-oxo-1H-pyridine-3,5-dicarboxylic acid |
|---|---|
| PubChem CID | 169405481 |
| Molecular Formula | C18H19FN2O6 |
| Molecular Weight | 378.36 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | 2-amino-4-(4-fluoro-3-pentoxyphenyl)-6-oxo-1H-pyridine-3,5-dicarboxylic acid |
| SMILES | CCCCCOc1cc(-c2c(C(=O)O)c(N)[nH]c(=O)c2C(=O)O)ccc1F |
| InChI | InChI=1S/C18H19FN2O6/c1-2-3-4-7-27-11-8-9(5-6-10(11)19)12-13(17(23)24)15(20)21-16(22)14(12)18(25)26/h5-6,8H,2-4,7H2,1H3,(H,23,24)(H,25,26)(H3,20,21,22) |
| InChIKey | BURRJWPOSSTGAM-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 142.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.36 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|