C18H20N2O5 — CID 169406597
2-amino-6-oxo-4-(4-pentylphenyl)-1H-pyridine-3,5-dicarboxylic acid (PubChem CID 169406597) has the molecular formula C18H20N2O5 and a molecular weight of 344.37 g/mol. Its IUPAC name is 2-amino-6-oxo-4-(4-pentylphenyl)-1H-pyridine-3,5-dicarboxylic acid.
| Compound Name | 2-amino-6-oxo-4-(4-pentylphenyl)-1H-pyridine-3,5-dicarboxylic acid |
|---|---|
| PubChem CID | 169406597 |
| Molecular Formula | C18H20N2O5 |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | 2-amino-6-oxo-4-(4-pentylphenyl)-1H-pyridine-3,5-dicarboxylic acid |
| SMILES | CCCCCc1ccc(-c2c(C(=O)O)c(N)[nH]c(=O)c2C(=O)O)cc1 |
| InChI | InChI=1S/C18H20N2O5/c1-2-3-4-5-10-6-8-11(9-7-10)12-13(17(22)23)15(19)20-16(21)14(12)18(24)25/h6-9H,2-5H2,1H3,(H,22,23)(H,24,25)(H3,19,20,21) |
| InChIKey | YGKIFBWWYHXDNP-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 133.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|