C20H24N2O6 — CID 169405574
2-amino-4-[2-(hexoxymethyl)phenyl]-6-oxo-1H-pyridine-3,5-dicarboxylic acid (PubChem CID 169405574) has the molecular formula C20H24N2O6 and a molecular weight of 388.42 g/mol. Its IUPAC name is 2-amino-4-[2-(hexoxymethyl)phenyl]-6-oxo-1H-pyridine-3,5-dicarboxylic acid.
| Compound Name | 2-amino-4-[2-(hexoxymethyl)phenyl]-6-oxo-1H-pyridine-3,5-dicarboxylic acid |
|---|---|
| PubChem CID | 169405574 |
| Molecular Formula | C20H24N2O6 |
| Molecular Weight | 388.42 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | 2-amino-4-[2-(hexoxymethyl)phenyl]-6-oxo-1H-pyridine-3,5-dicarboxylic acid |
| SMILES | CCCCCCOCc1ccccc1-c1c(C(=O)O)c(N)[nH]c(=O)c1C(=O)O |
| InChI | InChI=1S/C20H24N2O6/c1-2-3-4-7-10-28-11-12-8-5-6-9-13(12)14-15(19(24)25)17(21)22-18(23)16(14)20(26)27/h5-6,8-9H,2-4,7,10-11H2,1H3,(H,24,25)(H,26,27)(H3,21,22,23) |
| InChIKey | YHQPGTFXGDOJIV-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 142.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.42 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|