C13H10N2O8S — CID 169405007
2-amino-6-oxo-4-(2-sulfophenyl)-1H-pyridine-3,5-dicarboxylic acid (PubChem CID 169405007) has the molecular formula C13H10N2O8S and a molecular weight of 354.30 g/mol. Its IUPAC name is 2-amino-6-oxo-4-(2-sulfophenyl)-1H-pyridine-3,5-dicarboxylic acid.
| Compound Name | 2-amino-6-oxo-4-(2-sulfophenyl)-1H-pyridine-3,5-dicarboxylic acid |
|---|---|
| PubChem CID | 169405007 |
| Molecular Formula | C13H10N2O8S |
| Molecular Weight | 354.30 g/mol |
| Exact Mass | 354.02 |
| IUPAC Name | 2-amino-6-oxo-4-(2-sulfophenyl)-1H-pyridine-3,5-dicarboxylic acid |
| SMILES | Nc1[nH]c(=O)c(C(=O)O)c(-c2ccccc2S(=O)(=O)O)c1C(=O)O |
| InChI | InChI=1S/C13H10N2O8S/c14-10-8(12(17)18)7(9(13(19)20)11(16)15-10)5-3-1-2-4-6(5)24(21,22)23/h1-4H,(H,17,18)(H,19,20)(H3,14,15,16)(H,21,22,23) |
| InChIKey | LVUSMKIZHAMLTR-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 187.85 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.30 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|