C19H14N2O7S — CID 169406058
2-amino-4-[2-(benzenesulfonyl)phenyl]-6-oxo-1H-pyridine-3,5-dicarboxylic acid (PubChem CID 169406058) has the molecular formula C19H14N2O7S and a molecular weight of 414.40 g/mol. Its IUPAC name is 2-amino-4-[2-(benzenesulfonyl)phenyl]-6-oxo-1H-pyridine-3,5-dicarboxylic acid.
| Compound Name | 2-amino-4-[2-(benzenesulfonyl)phenyl]-6-oxo-1H-pyridine-3,5-dicarboxylic acid |
|---|---|
| PubChem CID | 169406058 |
| Molecular Formula | C19H14N2O7S |
| Molecular Weight | 414.40 g/mol |
| Exact Mass | 414.05 |
| IUPAC Name | 2-amino-4-[2-(benzenesulfonyl)phenyl]-6-oxo-1H-pyridine-3,5-dicarboxylic acid |
| SMILES | Nc1[nH]c(=O)c(C(=O)O)c(-c2ccccc2S(=O)(=O)c2ccccc2)c1C(=O)O |
| InChI | InChI=1S/C19H14N2O7S/c20-16-14(18(23)24)13(15(19(25)26)17(22)21-16)11-8-4-5-9-12(11)29(27,28)10-6-2-1-3-7-10/h1-9H,(H,23,24)(H,25,26)(H3,20,21,22) |
| InChIKey | ZGZFELMJSYXUTI-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 167.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.40 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |