C19H19BrN4O3 — CID 169395066
2-amino-4-(2-bromo-4-butoxy-5-ethoxyphenyl)-6-oxo-1H-pyridine-3,5-dicarbonitrile (PubChem CID 169395066) has the molecular formula C19H19BrN4O3 and a molecular weight of 431.29 g/mol. Its IUPAC name is 2-amino-4-(2-bromo-4-butoxy-5-ethoxyphenyl)-6-oxo-1H-pyridine-3,5-dicarbonitrile.
| Compound Name | 2-amino-4-(2-bromo-4-butoxy-5-ethoxyphenyl)-6-oxo-1H-pyridine-3,5-dicarbonitrile |
|---|---|
| PubChem CID | 169395066 |
| Molecular Formula | C19H19BrN4O3 |
| Molecular Weight | 431.29 g/mol |
| Exact Mass | 430.06 |
| IUPAC Name | 2-amino-4-(2-bromo-4-butoxy-5-ethoxyphenyl)-6-oxo-1H-pyridine-3,5-dicarbonitrile |
| SMILES | CCCCOc1cc(Br)c(-c2c(C#N)c(N)[nH]c(=O)c2C#N)cc1OCC |
| InChI | InChI=1S/C19H19BrN4O3/c1-3-5-6-27-16-8-14(20)11(7-15(16)26-4-2)17-12(9-21)18(23)24-19(25)13(17)10-22/h7-8H,3-6H2,1-2H3,(H3,23,24,25) |
| InChIKey | GZYDRGBHIWUTRH-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 124.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.29 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|