About 2-[4-(2-amino-3,5-dicyano-6-oxo-1H-pyridin-4-yl)-5-bromo-2-methoxyphenoxy]ethyl acetate
2-[4-(2-amino-3,5-dicyano-6-oxo-1H-pyridin-4-yl)-5-bromo-2-methoxyphenoxy]ethyl acetate (PubChem CID 169395184) has the molecular formula C18H15BrN4O5
and a molecular weight of 447.25 g/mol. Its IUPAC name is 2-[4-(2-amino-3,5-dicyano-6-oxo-1H-pyridin-4-yl)-5-bromo-2-methoxyphenoxy]ethyl acetate.
Molecular Properties
| Compound Name | 2-[4-(2-amino-3,5-dicyano-6-oxo-1H-pyridin-4-yl)-5-bromo-2-methoxyphenoxy]ethyl acetate |
| PubChem CID | 169395184 |
| Molecular Formula | C18H15BrN4O5 |
| Molecular Weight | 447.25 g/mol |
| Exact Mass | 446.02 |
| IUPAC Name | 2-[4-(2-amino-3,5-dicyano-6-oxo-1H-pyridin-4-yl)-5-bromo-2-methoxyphenoxy]ethyl acetate |
| SMILES | COc1cc(-c2c(C#N)c(N)[nH]c(=O)c2C#N)c(Br)cc1OCCOC(C)=O |
| InChI | InChI=1S/C18H15BrN4O5/c1-9(24)27-3-4-28-15-6-13(19)10(5-14(15)26-2)16-11(7-20)17(22)23-18(25)12(16)8-21/h5-6H,3-4H2,1-2H3,(H3,22,23,25) |
| InChIKey | OISIDEJZLPVDIA-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 151.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 447.25 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-(2-amino-3,5-dicyano-6-oxo-1H-pyridin-4-yl)-5-bromo-2-methoxyphenoxy]ethyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(2-amino-3,5-dicyano-6-oxo-1H-pyridin-4-yl)-5-bromo-2-methoxyphenoxy]ethyl acetate?
The IUPAC name of 2-[4-(2-amino-3,5-dicyano-6-oxo-1H-pyridin-4-yl)-5-bromo-2-methoxyphenoxy]ethyl acetate (CID 169395184) is 2-[4-(2-amino-3,5-dicyano-6-oxo-1H-pyridin-4-yl)-5-bromo-2-methoxyphenoxy]ethyl acetate.
What is the SMILES notation for 2-[4-(2-amino-3,5-dicyano-6-oxo-1H-pyridin-4-yl)-5-bromo-2-methoxyphenoxy]ethyl acetate?
The canonical SMILES for 2-[4-(2-amino-3,5-dicyano-6-oxo-1H-pyridin-4-yl)-5-bromo-2-methoxyphenoxy]ethyl acetate is COc1cc(-c2c(C#N)c(N)[nH]c(=O)c2C#N)c(Br)cc1OCCOC(C)=O.
What is the InChIKey of 2-[4-(2-amino-3,5-dicyano-6-oxo-1H-pyridin-4-yl)-5-bromo-2-methoxyphenoxy]ethyl acetate?
The InChIKey is OISIDEJZLPVDIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15BrN4O5/c1-9(24)27-3-4-28-15-6-13(19)10(5-14(15)26-2)16-11(7-20)17(22)23-18(25)12(16)8-21/h5-6H,3-4H2,1-2H3,(H3,22,23,25).
What are the key properties of 2-[4-(2-amino-3,5-dicyano-6-oxo-1H-pyridin-4-yl)-5-bromo-2-methoxyphenoxy]ethyl acetate?
2-[4-(2-amino-3,5-dicyano-6-oxo-1H-pyridin-4-yl)-5-bromo-2-methoxyphenoxy]ethyl acetate has a molecular weight of 447.25 g/mol, XLogP of 2.08, 6 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(2-amino-3,5-dicyano-6-oxo-1H-pyridin-4-yl)-5-bromo-2-methoxyphenoxy]ethyl acetate is sourced from PubChem (CID 169395184), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).