C18H17BrN2O5 — CID 168586178
2-[5-bromo-4-(3-cyano-6-methyl-2-oxo-1H-pyridin-4-yl)-2-methoxyphenoxy]ethyl acetate (PubChem CID 168586178) has the molecular formula C18H17BrN2O5 and a molecular weight of 421.25 g/mol. Its IUPAC name is 2-[5-bromo-4-(3-cyano-6-methyl-2-oxo-1H-pyridin-4-yl)-2-methoxyphenoxy]ethyl acetate.
| Compound Name | 2-[5-bromo-4-(3-cyano-6-methyl-2-oxo-1H-pyridin-4-yl)-2-methoxyphenoxy]ethyl acetate |
|---|---|
| PubChem CID | 168586178 |
| Molecular Formula | C18H17BrN2O5 |
| Molecular Weight | 421.25 g/mol |
| Exact Mass | 420.03 |
| IUPAC Name | 2-[5-bromo-4-(3-cyano-6-methyl-2-oxo-1H-pyridin-4-yl)-2-methoxyphenoxy]ethyl acetate |
| SMILES | COc1cc(-c2cc(C)[nH]c(=O)c2C#N)c(Br)cc1OCCOC(C)=O |
| InChI | InChI=1S/C18H17BrN2O5/c1-10-6-12(14(9-20)18(23)21-10)13-7-16(24-3)17(8-15(13)19)26-5-4-25-11(2)22/h6-8H,4-5H2,1-3H3,(H,21,23) |
| InChIKey | PJYIDEJRVZOXHC-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 101.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.25 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|