C16H14N2O5 — CID 168587366
2-[4-(3-cyano-6-methyl-2-oxo-1H-pyridin-4-yl)-2-methoxyphenoxy]acetic acid (PubChem CID 168587366) has the molecular formula C16H14N2O5 and a molecular weight of 314.30 g/mol. Its IUPAC name is 2-[4-(3-cyano-6-methyl-2-oxo-1H-pyridin-4-yl)-2-methoxyphenoxy]acetic acid.
| Compound Name | 2-[4-(3-cyano-6-methyl-2-oxo-1H-pyridin-4-yl)-2-methoxyphenoxy]acetic acid |
|---|---|
| PubChem CID | 168587366 |
| Molecular Formula | C16H14N2O5 |
| Molecular Weight | 314.30 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | 2-[4-(3-cyano-6-methyl-2-oxo-1H-pyridin-4-yl)-2-methoxyphenoxy]acetic acid |
| SMILES | COc1cc(-c2cc(C)[nH]c(=O)c2C#N)ccc1OCC(=O)O |
| InChI | InChI=1S/C16H14N2O5/c1-9-5-11(12(7-17)16(21)18-9)10-3-4-13(14(6-10)22-2)23-8-15(19)20/h3-6H,8H2,1-2H3,(H,18,21)(H,19,20) |
| InChIKey | QKJNHKVVQGSTNW-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 112.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.30 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |