C15H12N2O4 — CID 168586784
2-[3-(3-cyano-6-methyl-2-oxo-1H-pyridin-4-yl)phenoxy]acetic acid (PubChem CID 168586784) has the molecular formula C15H12N2O4 and a molecular weight of 284.27 g/mol. Its IUPAC name is 2-[3-(3-cyano-6-methyl-2-oxo-1H-pyridin-4-yl)phenoxy]acetic acid.
| Compound Name | 2-[3-(3-cyano-6-methyl-2-oxo-1H-pyridin-4-yl)phenoxy]acetic acid |
|---|---|
| PubChem CID | 168586784 |
| Molecular Formula | C15H12N2O4 |
| Molecular Weight | 284.27 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | 2-[3-(3-cyano-6-methyl-2-oxo-1H-pyridin-4-yl)phenoxy]acetic acid |
| SMILES | Cc1cc(-c2cccc(OCC(=O)O)c2)c(C#N)c(=O)[nH]1 |
| InChI | InChI=1S/C15H12N2O4/c1-9-5-12(13(7-16)15(20)17-9)10-3-2-4-11(6-10)21-8-14(18)19/h2-6H,8H2,1H3,(H,17,20)(H,18,19) |
| InChIKey | FOOMHEYQPCILEL-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 103.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.27 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |