C14H13BN2O4 — CID 168584762
[5-(3-cyano-6-methyl-2-oxo-1H-pyridin-4-yl)-2-methoxyphenyl]boronic acid (PubChem CID 168584762) has the molecular formula C14H13BN2O4 and a molecular weight of 284.08 g/mol. Its IUPAC name is [5-(3-cyano-6-methyl-2-oxo-1H-pyridin-4-yl)-2-methoxyphenyl]boronic acid.
| Compound Name | [5-(3-cyano-6-methyl-2-oxo-1H-pyridin-4-yl)-2-methoxyphenyl]boronic acid |
|---|---|
| PubChem CID | 168584762 |
| Molecular Formula | C14H13BN2O4 |
| Molecular Weight | 284.08 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | [5-(3-cyano-6-methyl-2-oxo-1H-pyridin-4-yl)-2-methoxyphenyl]boronic acid |
| SMILES | COc1ccc(-c2cc(C)[nH]c(=O)c2C#N)cc1B(O)O |
| InChI | InChI=1S/C14H13BN2O4/c1-8-5-10(11(7-16)14(18)17-8)9-3-4-13(21-2)12(6-9)15(19)20/h3-6,19-20H,1-2H3,(H,17,18) |
| InChIKey | FFSIKUPFMWRHQY-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.08 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|