C19H14N2O4S — CID 168587376
[4-(3-cyano-6-methyl-2-oxo-1H-pyridin-4-yl)-2-methoxyphenyl] thiophene-2-carboxylate (PubChem CID 168587376) has the molecular formula C19H14N2O4S and a molecular weight of 366.40 g/mol. Its IUPAC name is [4-(3-cyano-6-methyl-2-oxo-1H-pyridin-4-yl)-2-methoxyphenyl] thiophene-2-carboxylate.
| Compound Name | [4-(3-cyano-6-methyl-2-oxo-1H-pyridin-4-yl)-2-methoxyphenyl] thiophene-2-carboxylate |
|---|---|
| PubChem CID | 168587376 |
| Molecular Formula | C19H14N2O4S |
| Molecular Weight | 366.40 g/mol |
| Exact Mass | 366.07 |
| IUPAC Name | [4-(3-cyano-6-methyl-2-oxo-1H-pyridin-4-yl)-2-methoxyphenyl] thiophene-2-carboxylate |
| SMILES | COc1cc(-c2cc(C)[nH]c(=O)c2C#N)ccc1OC(=O)c1cccs1 |
| InChI | InChI=1S/C19H14N2O4S/c1-11-8-13(14(10-20)18(22)21-11)12-5-6-15(16(9-12)24-2)25-19(23)17-4-3-7-26-17/h3-9H,1-2H3,(H,21,22) |
| InChIKey | GDZSRZBOKFRKHG-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.40 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|