C22H17ClN2O4 — CID 168586600
[4-(3-cyano-6-methyl-2-oxo-1H-pyridin-4-yl)-2-ethoxyphenyl] 2-chlorobenzoate (PubChem CID 168586600) has the molecular formula C22H17ClN2O4 and a molecular weight of 408.84 g/mol. Its IUPAC name is [4-(3-cyano-6-methyl-2-oxo-1H-pyridin-4-yl)-2-ethoxyphenyl] 2-chlorobenzoate.
| Compound Name | [4-(3-cyano-6-methyl-2-oxo-1H-pyridin-4-yl)-2-ethoxyphenyl] 2-chlorobenzoate |
|---|---|
| PubChem CID | 168586600 |
| Molecular Formula | C22H17ClN2O4 |
| Molecular Weight | 408.84 g/mol |
| Exact Mass | 408.09 |
| IUPAC Name | [4-(3-cyano-6-methyl-2-oxo-1H-pyridin-4-yl)-2-ethoxyphenyl] 2-chlorobenzoate |
| SMILES | CCOc1cc(-c2cc(C)[nH]c(=O)c2C#N)ccc1OC(=O)c1ccccc1Cl |
| InChI | InChI=1S/C22H17ClN2O4/c1-3-28-20-11-14(16-10-13(2)25-21(26)17(16)12-24)8-9-19(20)29-22(27)15-6-4-5-7-18(15)23/h4-11H,3H2,1-2H3,(H,25,26) |
| InChIKey | MMOAQBOLCQFMJD-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.84 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|