C21H15ClN2O4 — CID 168586606
[4-(3-cyano-6-methyl-2-oxo-1H-pyridin-4-yl)-2-methoxyphenyl] 4-chlorobenzoate (PubChem CID 168586606) has the molecular formula C21H15ClN2O4 and a molecular weight of 394.81 g/mol. Its IUPAC name is [4-(3-cyano-6-methyl-2-oxo-1H-pyridin-4-yl)-2-methoxyphenyl] 4-chlorobenzoate.
| Compound Name | [4-(3-cyano-6-methyl-2-oxo-1H-pyridin-4-yl)-2-methoxyphenyl] 4-chlorobenzoate |
|---|---|
| PubChem CID | 168586606 |
| Molecular Formula | C21H15ClN2O4 |
| Molecular Weight | 394.81 g/mol |
| Exact Mass | 394.07 |
| IUPAC Name | [4-(3-cyano-6-methyl-2-oxo-1H-pyridin-4-yl)-2-methoxyphenyl] 4-chlorobenzoate |
| SMILES | COc1cc(-c2cc(C)[nH]c(=O)c2C#N)ccc1OC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H15ClN2O4/c1-12-9-16(17(11-23)20(25)24-12)14-5-8-18(19(10-14)27-2)28-21(26)13-3-6-15(22)7-4-13/h3-10H,1-2H3,(H,24,25) |
| InChIKey | FUFIQJMPNONBCO-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.81 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|