C21H14Cl2N2O4 — CID 168586584
[4-(3-cyano-6-methyl-2-oxo-1H-pyridin-4-yl)-2-methoxyphenyl] 2,4-dichlorobenzoate (PubChem CID 168586584) has the molecular formula C21H14Cl2N2O4 and a molecular weight of 429.26 g/mol. Its IUPAC name is [4-(3-cyano-6-methyl-2-oxo-1H-pyridin-4-yl)-2-methoxyphenyl] 2,4-dichlorobenzoate.
| Compound Name | [4-(3-cyano-6-methyl-2-oxo-1H-pyridin-4-yl)-2-methoxyphenyl] 2,4-dichlorobenzoate |
|---|---|
| PubChem CID | 168586584 |
| Molecular Formula | C21H14Cl2N2O4 |
| Molecular Weight | 429.26 g/mol |
| Exact Mass | 428.03 |
| IUPAC Name | [4-(3-cyano-6-methyl-2-oxo-1H-pyridin-4-yl)-2-methoxyphenyl] 2,4-dichlorobenzoate |
| SMILES | COc1cc(-c2cc(C)[nH]c(=O)c2C#N)ccc1OC(=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C21H14Cl2N2O4/c1-11-7-15(16(10-24)20(26)25-11)12-3-6-18(19(8-12)28-2)29-21(27)14-5-4-13(22)9-17(14)23/h3-9H,1-2H3,(H,25,26) |
| InChIKey | JIORDYGHTDBECP-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.26 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|